C15H21Cl2NO — CID 903787
N,N-bis[(2R)-butan-2-yl]-2,6-dichlorobenzamide (PubChem CID 903787) has the molecular formula C15H21Cl2NO and a molecular weight of 302.24 g/mol. Its IUPAC name is N,N-bis[(2R)-butan-2-yl]-2,6-dichlorobenzamide.
| Compound Name | N,N-bis[(2R)-butan-2-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 903787 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N,N-bis[(2R)-butan-2-yl]-2,6-dichlorobenzamide |
| SMILES | CC[C@@H](C)N(C(=O)c1c(Cl)cccc1Cl)[C@H](C)CC |
| InChI | InChI=1S/C15H21Cl2NO/c1-5-10(3)18(11(4)6-2)15(19)14-12(16)8-7-9-13(14)17/h7-11H,5-6H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | ACZAVKVQOOZHDY-GHMZBOCLSA-N |
| XLogP | 5.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |