C15H21Cl2NO — CID 114079709
3-[butan-2-yl(ethyl)amino]-1-(2,3-dichlorophenyl)propan-1-one (PubChem CID 114079709) has the molecular formula C15H21Cl2NO and a molecular weight of 302.24 g/mol. Its IUPAC name is 3-[butan-2-yl(ethyl)amino]-1-(2,3-dichlorophenyl)propan-1-one.
| Compound Name | 3-[butan-2-yl(ethyl)amino]-1-(2,3-dichlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 114079709 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-[butan-2-yl(ethyl)amino]-1-(2,3-dichlorophenyl)propan-1-one |
| SMILES | CCC(C)N(CC)CCC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H21Cl2NO/c1-4-11(3)18(5-2)10-9-14(19)12-7-6-8-13(16)15(12)17/h6-8,11H,4-5,9-10H2,1-3H3 |
| InChIKey | FMDZUNLXNXOAIX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |