C12H16ClNOS — CID 71442782
2-chloro-N,N-diethyl-6-methylsulfanylbenzamide (PubChem CID 71442782) has the molecular formula C12H16ClNOS and a molecular weight of 257.79 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-6-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N,N-diethyl-6-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 71442782 |
| Molecular Formula | C12H16ClNOS |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-chloro-N,N-diethyl-6-methylsulfanylbenzamide |
| SMILES | CCN(CC)C(=O)c1c(Cl)cccc1SC |
| InChI | InChI=1S/C12H16ClNOS/c1-4-14(5-2)12(15)11-9(13)7-6-8-10(11)16-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | UNWAPZXXEWCBOQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |