C14H21ClFNOSi — CID 18630158
6-chloro-N,N-diethyl-3-fluoro-2-trimethylsilylbenzamide (PubChem CID 18630158) has the molecular formula C14H21ClFNOSi and a molecular weight of 301.87 g/mol. Its IUPAC name is 6-chloro-N,N-diethyl-3-fluoro-2-trimethylsilylbenzamide.
| Compound Name | 6-chloro-N,N-diethyl-3-fluoro-2-trimethylsilylbenzamide |
|---|---|
| PubChem CID | 18630158 |
| Molecular Formula | C14H21ClFNOSi |
| Molecular Weight | 301.87 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 6-chloro-N,N-diethyl-3-fluoro-2-trimethylsilylbenzamide |
| SMILES | CCN(CC)C(=O)c1c(Cl)ccc(F)c1[Si](C)(C)C |
| InChI | InChI=1S/C14H21ClFNOSi/c1-6-17(7-2)14(18)12-10(15)8-9-11(16)13(12)19(3,4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | PRAUJNZVJJJEDC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|