C12H15ClFNO2 — CID 162421154
2-chloro-N,N-diethyl-4-fluoro-3-methoxybenzamide (PubChem CID 162421154) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-fluoro-3-methoxybenzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-fluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 162421154 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-fluoro-3-methoxybenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(F)c(OC)c1Cl |
| InChI | InChI=1S/C12H15ClFNO2/c1-4-15(5-2)12(16)8-6-7-9(14)11(17-3)10(8)13/h6-7H,4-5H2,1-3H3 |
| InChIKey | VYHYLARYLBVRFO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |