C13H18FNO — CID 69055558
N,N,4-triethyl-2-fluorobenzamide (PubChem CID 69055558) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is N,N,4-triethyl-2-fluorobenzamide.
| Compound Name | N,N,4-triethyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 69055558 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N,N,4-triethyl-2-fluorobenzamide |
| SMILES | CCc1ccc(C(=O)N(CC)CC)c(F)c1 |
| InChI | InChI=1S/C13H18FNO/c1-4-10-7-8-11(12(14)9-10)13(16)15(5-2)6-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | DVLVPYXYGCUDIW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |