C12H15BrFNO — CID 146171179
5-bromo-N,N-diethyl-2-fluoro-4-methylbenzamide (PubChem CID 146171179) has the molecular formula C12H15BrFNO and a molecular weight of 288.16 g/mol. Its IUPAC name is 5-bromo-N,N-diethyl-2-fluoro-4-methylbenzamide.
| Compound Name | 5-bromo-N,N-diethyl-2-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 146171179 |
| Molecular Formula | C12H15BrFNO |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 5-bromo-N,N-diethyl-2-fluoro-4-methylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(Br)c(C)cc1F |
| InChI | InChI=1S/C12H15BrFNO/c1-4-15(5-2)12(16)9-7-10(13)8(3)6-11(9)14/h6-7H,4-5H2,1-3H3 |
| InChIKey | QXJXHWGRZYBLMA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |