C12H13F2NO2 — CID 82544316
N,N-diethyl-3,5-difluoro-2-formylbenzamide (PubChem CID 82544316) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is N,N-diethyl-3,5-difluoro-2-formylbenzamide.
| Compound Name | N,N-diethyl-3,5-difluoro-2-formylbenzamide |
|---|---|
| PubChem CID | 82544316 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N,N-diethyl-3,5-difluoro-2-formylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(F)cc(F)c1C=O |
| InChI | InChI=1S/C12H13F2NO2/c1-3-15(4-2)12(17)9-5-8(13)6-11(14)10(9)7-16/h5-7H,3-4H2,1-2H3 |
| InChIKey | VEZGUASULLYXBX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|