C12H13Cl2NO2 — CID 82544303
3,5-dichloro-N,N-diethyl-2-formylbenzamide (PubChem CID 82544303) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is 3,5-dichloro-N,N-diethyl-2-formylbenzamide.
| Compound Name | 3,5-dichloro-N,N-diethyl-2-formylbenzamide |
|---|---|
| PubChem CID | 82544303 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 3,5-dichloro-N,N-diethyl-2-formylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(Cl)cc(Cl)c1C=O |
| InChI | InChI=1S/C12H13Cl2NO2/c1-3-15(4-2)12(17)9-5-8(13)6-11(14)10(9)7-16/h5-7H,3-4H2,1-2H3 |
| InChIKey | MMEUPARFNXNDBM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|