C23H37Cl2NO2 — CID 166025778
3,5-dichloro-N,N-bis(2-ethylhexyl)-2-hydroxybenzamide (PubChem CID 166025778) has the molecular formula C23H37Cl2NO2 and a molecular weight of 430.46 g/mol. Its IUPAC name is 3,5-dichloro-N,N-bis(2-ethylhexyl)-2-hydroxybenzamide.
| Compound Name | 3,5-dichloro-N,N-bis(2-ethylhexyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 166025778 |
| Molecular Formula | C23H37Cl2NO2 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 3,5-dichloro-N,N-bis(2-ethylhexyl)-2-hydroxybenzamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C23H37Cl2NO2/c1-5-9-11-17(7-3)15-26(16-18(8-4)12-10-6-2)23(28)20-13-19(24)14-21(25)22(20)27/h13-14,17-18,27H,5-12,15-16H2,1-4H3 |
| InChIKey | OAWUIGDHHJLNDD-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |