C32H50N2O4 — CID 169045315
N-[5-[bis(2-ethylhexyl)amino]-2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]-2,2-dimethylbutanamide (PubChem CID 169045315) has the molecular formula C32H50N2O4 and a molecular weight of 526.76 g/mol. Its IUPAC name is N-[5-[bis(2-ethylhexyl)amino]-2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[5-[bis(2-ethylhexyl)amino]-2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 169045315 |
| Molecular Formula | C32H50N2O4 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.38 |
| IUPAC Name | N-[5-[bis(2-ethylhexyl)amino]-2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]-2,2-dimethylbutanamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1ccc(-c2c(O)c(=O)c2=O)c(NC(=O)C(C)(C)CC)c1 |
| InChI | InChI=1S/C32H50N2O4/c1-8-13-15-22(10-3)20-34(21-23(11-4)16-14-9-2)24-17-18-25(27-28(35)30(37)29(27)36)26(19-24)33-31(38)32(6,7)12-5/h17-19,22-23,35H,8-16,20-21H2,1-7H3,(H,33,38) |
| InChIKey | ANSOWPANEZSLNC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|