C61H86N2O6 — CID 139908339
[4-[3-[4-[4-[bis(2-ethylhexyl)amino]benzoyl]oxyphenyl]-3-oxopropanoyl]phenyl] 4-[bis(2-ethylhexyl)amino]benzoate (PubChem CID 139908339) has the molecular formula C61H86N2O6 and a molecular weight of 943.37 g/mol. Its IUPAC name is [4-[3-[4-[4-[bis(2-ethylhexyl)amino]benzoyl]oxyphenyl]-3-oxopropanoyl]phenyl] 4-[bis(2-ethylhexyl)amino]benzoate.
| Compound Name | [4-[3-[4-[4-[bis(2-ethylhexyl)amino]benzoyl]oxyphenyl]-3-oxopropanoyl]phenyl] 4-[bis(2-ethylhexyl)amino]benzoate |
|---|---|
| PubChem CID | 139908339 |
| Molecular Formula | C61H86N2O6 |
| Molecular Weight | 943.37 g/mol |
| Exact Mass | 942.65 |
| IUPAC Name | [4-[3-[4-[4-[bis(2-ethylhexyl)amino]benzoyl]oxyphenyl]-3-oxopropanoyl]phenyl] 4-[bis(2-ethylhexyl)amino]benzoate |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1ccc(C(=O)Oc2ccc(C(=O)CC(=O)c3ccc(OC(=O)c4ccc(N(CC(CC)CCCC)CC(CC)CCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C61H86N2O6/c1-9-17-21-46(13-5)42-62(43-47(14-6)22-18-10-2)54-33-25-52(26-34-54)60(66)68-56-37-29-50(30-38-56)58(64)41-59(65)51-31-39-57(40-32-51)69-61(67)53-27-35-55(36-28-53)63(44-48(15-7)23-19-11-3)45-49(16-8)24-20-12-4/h25-40,46-49H,9-24,41-45H2,1-8H3 |
| InChIKey | JEMGSILQBAAUNQ-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.37 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|