C36H47NO4 — CID 54198861
(4-benzoyl-3-hydroxyphenyl) 4-[bis(2-ethylhexyl)amino]benzoate (PubChem CID 54198861) has the molecular formula C36H47NO4 and a molecular weight of 557.78 g/mol. Its IUPAC name is (4-benzoyl-3-hydroxyphenyl) 4-[bis(2-ethylhexyl)amino]benzoate.
| Compound Name | (4-benzoyl-3-hydroxyphenyl) 4-[bis(2-ethylhexyl)amino]benzoate |
|---|---|
| PubChem CID | 54198861 |
| Molecular Formula | C36H47NO4 |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.35 |
| IUPAC Name | (4-benzoyl-3-hydroxyphenyl) 4-[bis(2-ethylhexyl)amino]benzoate |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1ccc(C(=O)Oc2ccc(C(=O)c3ccccc3)c(O)c2)cc1 |
| InChI | InChI=1S/C36H47NO4/c1-5-9-14-27(7-3)25-37(26-28(8-4)15-10-6-2)31-20-18-30(19-21-31)36(40)41-32-22-23-33(34(38)24-32)35(39)29-16-12-11-13-17-29/h11-13,16-24,27-28,38H,5-10,14-15,25-26H2,1-4H3 |
| InChIKey | PNUITNRIYUEQQH-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|