C35H36O6 — CID 175119265
(3-methylphenyl) 4-[8-(4-benzoyl-3-hydroxyphenoxy)octoxy]benzoate (PubChem CID 175119265) has the molecular formula C35H36O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is (3-methylphenyl) 4-[8-(4-benzoyl-3-hydroxyphenoxy)octoxy]benzoate.
| Compound Name | (3-methylphenyl) 4-[8-(4-benzoyl-3-hydroxyphenoxy)octoxy]benzoate |
|---|---|
| PubChem CID | 175119265 |
| Molecular Formula | C35H36O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (3-methylphenyl) 4-[8-(4-benzoyl-3-hydroxyphenoxy)octoxy]benzoate |
| SMILES | Cc1cccc(OC(=O)c2ccc(OCCCCCCCCOc3ccc(C(=O)c4ccccc4)c(O)c3)cc2)c1 |
| InChI | InChI=1S/C35H36O6/c1-26-12-11-15-31(24-26)41-35(38)28-16-18-29(19-17-28)39-22-9-4-2-3-5-10-23-40-30-20-21-32(33(36)25-30)34(37)27-13-7-6-8-14-27/h6-8,11-21,24-25,36H,2-5,9-10,22-23H2,1H3 |
| InChIKey | JOVOIIPZXVKLST-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|