C22H28Cl2O3 — CID 174965909
dichloromethane;(2-hydroxy-4-octoxyphenyl)-phenylmethanone (PubChem CID 174965909) has the molecular formula C22H28Cl2O3 and a molecular weight of 411.37 g/mol. Its IUPAC name is dichloromethane;(2-hydroxy-4-octoxyphenyl)-phenylmethanone.
| Compound Name | dichloromethane;(2-hydroxy-4-octoxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 174965909 |
| Molecular Formula | C22H28Cl2O3 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | dichloromethane;(2-hydroxy-4-octoxyphenyl)-phenylmethanone |
| SMILES | CCCCCCCCOc1ccc(C(=O)c2ccccc2)c(O)c1.ClCCl |
| InChI | InChI=1S/C21H26O3.CH2Cl2/c1-2-3-4-5-6-10-15-24-18-13-14-19(20(22)16-18)21(23)17-11-8-7-9-12-17;2-1-3/h7-9,11-14,16,22H,2-6,10,15H2,1H3;1H2 |
| InChIKey | AYUUFFURVJOUOX-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|