C21H26O4 — CID 152720856
(2-hydroxy-4-octylperoxyphenyl)-phenylmethanone (PubChem CID 152720856) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2-hydroxy-4-octylperoxyphenyl)-phenylmethanone.
| Compound Name | (2-hydroxy-4-octylperoxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 152720856 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2-hydroxy-4-octylperoxyphenyl)-phenylmethanone |
| SMILES | CCCCCCCCOOc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C21H26O4/c1-2-3-4-5-6-10-15-24-25-18-13-14-19(20(22)16-18)21(23)17-11-8-7-9-12-17/h7-9,11-14,16,22H,2-6,10,15H2,1H3 |
| InChIKey | ZVPAETIMNGMSKO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|