C24H43NO — CID 59373143
4-ethoxy-N,N-bis(2-ethylhexyl)aniline (PubChem CID 59373143) has the molecular formula C24H43NO and a molecular weight of 361.61 g/mol. Its IUPAC name is 4-ethoxy-N,N-bis(2-ethylhexyl)aniline.
| Compound Name | 4-ethoxy-N,N-bis(2-ethylhexyl)aniline |
|---|---|
| PubChem CID | 59373143 |
| Molecular Formula | C24H43NO |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 361.33 |
| IUPAC Name | 4-ethoxy-N,N-bis(2-ethylhexyl)aniline |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C24H43NO/c1-6-11-13-21(8-3)19-25(20-22(9-4)14-12-7-2)23-15-17-24(18-16-23)26-10-5/h15-18,21-22H,6-14,19-20H2,1-5H3 |
| InChIKey | XJOAOMHUUSJHRK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|