C31H52N2O2 — CID 161278996
4-ethoxy-N,N-bis(2-methylpropyl)aniline;4-methoxy-N,N-bis(2-methylpropyl)aniline (PubChem CID 161278996) has the molecular formula C31H52N2O2 and a molecular weight of 484.77 g/mol. Its IUPAC name is 4-ethoxy-N,N-bis(2-methylpropyl)aniline;4-methoxy-N,N-bis(2-methylpropyl)aniline.
| Compound Name | 4-ethoxy-N,N-bis(2-methylpropyl)aniline;4-methoxy-N,N-bis(2-methylpropyl)aniline |
|---|---|
| PubChem CID | 161278996 |
| Molecular Formula | C31H52N2O2 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.40 |
| IUPAC Name | 4-ethoxy-N,N-bis(2-methylpropyl)aniline;4-methoxy-N,N-bis(2-methylpropyl)aniline |
| SMILES | CCOc1ccc(N(CC(C)C)CC(C)C)cc1.COc1ccc(N(CC(C)C)CC(C)C)cc1 |
| InChI | InChI=1S/C16H27NO.C15H25NO/c1-6-18-16-9-7-15(8-10-16)17(11-13(2)3)12-14(4)5;1-12(2)10-16(11-13(3)4)14-6-8-15(17-5)9-7-14/h7-10,13-14H,6,11-12H2,1-5H3;6-9,12-13H,10-11H2,1-5H3 |
| InChIKey | VEVCQMXZKYNOAL-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|