C11H17NO3 — CID 89468483
4-methoxy-N,N-bis(methoxymethyl)aniline (PubChem CID 89468483) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-methoxy-N,N-bis(methoxymethyl)aniline.
| Compound Name | 4-methoxy-N,N-bis(methoxymethyl)aniline |
|---|---|
| PubChem CID | 89468483 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-methoxy-N,N-bis(methoxymethyl)aniline |
| SMILES | COCN(COC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H17NO3/c1-13-8-12(9-14-2)10-4-6-11(15-3)7-5-10/h4-7H,8-9H2,1-3H3 |
| InChIKey | JTKWEQXFRNAMMN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|