C38H40N2O4 — CID 21254489
1-N,1-N,4-N,4-N-tetrakis[(4-methoxyphenyl)methyl]benzene-1,4-diamine (PubChem CID 21254489) has the molecular formula C38H40N2O4 and a molecular weight of 588.75 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N-tetrakis[(4-methoxyphenyl)methyl]benzene-1,4-diamine.
| Compound Name | 1-N,1-N,4-N,4-N-tetrakis[(4-methoxyphenyl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 21254489 |
| Molecular Formula | C38H40N2O4 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetrakis[(4-methoxyphenyl)methyl]benzene-1,4-diamine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2ccc(N(Cc3ccc(OC)cc3)Cc3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H40N2O4/c1-41-35-17-5-29(6-18-35)25-39(26-30-7-19-36(42-2)20-8-30)33-13-15-34(16-14-33)40(27-31-9-21-37(43-3)22-10-31)28-32-11-23-38(44-4)24-12-32/h5-24H,25-28H2,1-4H3 |
| InChIKey | JQRGFNLRUUDCEG-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|