C25H29NO — CID 138519701
N-(2,2-dimethylpropyl)-4-methoxy-N-[(4-phenylphenyl)methyl]aniline (PubChem CID 138519701) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-4-methoxy-N-[(4-phenylphenyl)methyl]aniline.
| Compound Name | N-(2,2-dimethylpropyl)-4-methoxy-N-[(4-phenylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 138519701 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-(2,2-dimethylpropyl)-4-methoxy-N-[(4-phenylphenyl)methyl]aniline |
| SMILES | COc1ccc(N(Cc2ccc(-c3ccccc3)cc2)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H29NO/c1-25(2,3)19-26(23-14-16-24(27-4)17-15-23)18-20-10-12-22(13-11-20)21-8-6-5-7-9-21/h5-17H,18-19H2,1-4H3 |
| InChIKey | GTVQQMIGACKZNC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|