C11H13NO5 — CID 4712243
2-[N-(carboxymethyl)-4-methoxyanilino]acetic acid (PubChem CID 4712243) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-[N-(carboxymethyl)-4-methoxyanilino]acetic acid.
| Compound Name | 2-[N-(carboxymethyl)-4-methoxyanilino]acetic acid |
|---|---|
| PubChem CID | 4712243 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-[N-(carboxymethyl)-4-methoxyanilino]acetic acid |
| SMILES | COc1ccc(N(CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C11H13NO5/c1-17-9-4-2-8(3-5-9)12(6-10(13)14)7-11(15)16/h2-5H,6-7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | FTEFUVAUCUCFIK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|