C16H24N4O4 — CID 25219972
2-(4-methoxy-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]anilino)acetic acid (PubChem CID 25219972) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-(4-methoxy-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]anilino)acetic acid.
| Compound Name | 2-(4-methoxy-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]anilino)acetic acid |
|---|---|
| PubChem CID | 25219972 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-(4-methoxy-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]anilino)acetic acid |
| SMILES | COc1ccc(N(CC(=O)O)CC(=O)NN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C16H24N4O4/c1-18-7-9-20(10-8-18)17-15(21)11-19(12-16(22)23)13-3-5-14(24-2)6-4-13/h3-6H,7-12H2,1-2H3,(H,17,21)(H,22,23) |
| InChIKey | XMYQQCOREXDLKD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|