C22H26N2O10 — CID 122452807
2-[N-(carboxymethyl)-3-methoxyanilino]acetic acid;2-[N-(carboxymethyl)-4-methoxyanilino]acetic acid (PubChem CID 122452807) has the molecular formula C22H26N2O10 and a molecular weight of 478.45 g/mol. Its IUPAC name is 2-[N-(carboxymethyl)-3-methoxyanilino]acetic acid;2-[N-(carboxymethyl)-4-methoxyanilino]acetic acid.
| Compound Name | 2-[N-(carboxymethyl)-3-methoxyanilino]acetic acid;2-[N-(carboxymethyl)-4-methoxyanilino]acetic acid |
|---|---|
| PubChem CID | 122452807 |
| Molecular Formula | C22H26N2O10 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-[N-(carboxymethyl)-3-methoxyanilino]acetic acid;2-[N-(carboxymethyl)-4-methoxyanilino]acetic acid |
| SMILES | COc1ccc(N(CC(=O)O)CC(=O)O)cc1.COc1cccc(N(CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/2C11H13NO5/c1-17-9-4-2-8(3-5-9)12(6-10(13)14)7-11(15)16;1-17-9-4-2-3-8(5-9)12(6-10(13)14)7-11(15)16/h2*2-5H,6-7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | ZGJXHQGEYGWAHL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 174.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|