C14H20N4O3 — CID 44995872
N-(4-methoxyphenyl)-N'-(4-methylpiperazin-1-yl)oxamide (PubChem CID 44995872) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N'-(4-methylpiperazin-1-yl)oxamide.
| Compound Name | N-(4-methoxyphenyl)-N'-(4-methylpiperazin-1-yl)oxamide |
|---|---|
| PubChem CID | 44995872 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-(4-methoxyphenyl)-N'-(4-methylpiperazin-1-yl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C14H20N4O3/c1-17-7-9-18(10-8-17)16-14(20)13(19)15-11-3-5-12(21-2)6-4-11/h3-6H,7-10H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | WUQNTOOOCDVPQK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|