C14H17N5O2S — CID 108527864
[4-[[2-[(4-methylpiperazin-1-yl)amino]-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108527864) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is [4-[[2-[(4-methylpiperazin-1-yl)amino]-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-[(4-methylpiperazin-1-yl)amino]-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108527864 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [4-[[2-[(4-methylpiperazin-1-yl)amino]-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | CN1CCN(NC(=O)C(=O)Nc2ccc(SC#N)cc2)CC1 |
| InChI | InChI=1S/C14H17N5O2S/c1-18-6-8-19(9-7-18)17-14(21)13(20)16-11-2-4-12(5-3-11)22-10-15/h2-5H,6-9H2,1H3,(H,16,20)(H,17,21) |
| InChIKey | JLBCKDYTORDAIV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|