C13H19N5O4S — CID 108508857
N'-(4-methylpiperazin-1-yl)-N-(4-sulfamoylphenyl)oxamide (PubChem CID 108508857) has the molecular formula C13H19N5O4S and a molecular weight of 341.39 g/mol. Its IUPAC name is N'-(4-methylpiperazin-1-yl)-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-(4-methylpiperazin-1-yl)-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508857 |
| Molecular Formula | C13H19N5O4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N'-(4-methylpiperazin-1-yl)-N-(4-sulfamoylphenyl)oxamide |
| SMILES | CN1CCN(NC(=O)C(=O)Nc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C13H19N5O4S/c1-17-6-8-18(9-7-17)16-13(20)12(19)15-10-2-4-11(5-3-10)23(14,21)22/h2-5H,6-9H2,1H3,(H,15,19)(H,16,20)(H2,14,21,22) |
| InChIKey | AVCDMULTIWSVPD-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|