C14H18N6O2 — CID 108529307
N-(3H-benzimidazol-5-yl)-N'-(4-methylpiperazin-1-yl)oxamide (PubChem CID 108529307) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-yl)-N'-(4-methylpiperazin-1-yl)oxamide.
| Compound Name | N-(3H-benzimidazol-5-yl)-N'-(4-methylpiperazin-1-yl)oxamide |
|---|---|
| PubChem CID | 108529307 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(3H-benzimidazol-5-yl)-N'-(4-methylpiperazin-1-yl)oxamide |
| SMILES | CN1CCN(NC(=O)C(=O)Nc2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C14H18N6O2/c1-19-4-6-20(7-5-19)18-14(22)13(21)17-10-2-3-11-12(8-10)16-9-15-11/h2-3,8-9H,4-7H2,1H3,(H,15,16)(H,17,21)(H,18,22) |
| InChIKey | LNCAZYORGWLSAG-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|