C11H10N4O3 — CID 166844884
(E)-N-(3H-benzimidazol-5-yl)-3-hydroxy-2-nitrosobut-2-enamide (PubChem CID 166844884) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is (E)-N-(3H-benzimidazol-5-yl)-3-hydroxy-2-nitrosobut-2-enamide.
| Compound Name | (E)-N-(3H-benzimidazol-5-yl)-3-hydroxy-2-nitrosobut-2-enamide |
|---|---|
| PubChem CID | 166844884 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (E)-N-(3H-benzimidazol-5-yl)-3-hydroxy-2-nitrosobut-2-enamide |
| SMILES | C/C(O)=C(\N=O)C(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C11H10N4O3/c1-6(16)10(15-18)11(17)14-7-2-3-8-9(4-7)13-5-12-8/h2-5,16H,1H3,(H,12,13)(H,14,17)/b10-6+ |
| InChIKey | UVBJDWCINUZHMN-UXBLZVDNSA-N |
| XLogP | 2.06 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|