C17H24N4O2 — CID 108529252
N-(3H-benzimidazol-5-yl)-N',N'-bis(2-methylpropyl)oxamide (PubChem CID 108529252) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-yl)-N',N'-bis(2-methylpropyl)oxamide.
| Compound Name | N-(3H-benzimidazol-5-yl)-N',N'-bis(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 108529252 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-(3H-benzimidazol-5-yl)-N',N'-bis(2-methylpropyl)oxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C17H24N4O2/c1-11(2)8-21(9-12(3)4)17(23)16(22)20-13-5-6-14-15(7-13)19-10-18-14/h5-7,10-12H,8-9H2,1-4H3,(H,18,19)(H,20,22) |
| InChIKey | QOKNXBHTGPWAHR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|