C18H18N4O2 — CID 108523245
N-(3H-benzimidazol-5-yl)-N'-benzyl-N'-ethyloxamide (PubChem CID 108523245) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-yl)-N'-benzyl-N'-ethyloxamide.
| Compound Name | N-(3H-benzimidazol-5-yl)-N'-benzyl-N'-ethyloxamide |
|---|---|
| PubChem CID | 108523245 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(3H-benzimidazol-5-yl)-N'-benzyl-N'-ethyloxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C18H18N4O2/c1-2-22(11-13-6-4-3-5-7-13)18(24)17(23)21-14-8-9-15-16(10-14)20-12-19-15/h3-10,12H,2,11H2,1H3,(H,19,20)(H,21,23) |
| InChIKey | DUVKIBMYMBOSHS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|