About N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide
N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide (PubChem CID 108523230) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide.
Molecular Properties
| Compound Name | N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide |
| PubChem CID | 108523230 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H23N3O2/c1-4-22(14-15-8-6-5-7-9-15)19(24)18(23)20-16-10-12-17(13-11-16)21(2)3/h5-13H,4,14H2,1-3H3,(H,20,23) |
| InChIKey | HJVIFXSFTLCCHI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide?
The IUPAC name of N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide (CID 108523230) is N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide.
What is the SMILES notation for N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide?
The canonical SMILES for N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide is CCN(Cc1ccccc1)C(=O)C(=O)Nc1ccc(N(C)C)cc1.
What is the InChIKey of N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide?
The InChIKey is HJVIFXSFTLCCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-4-22(14-15-8-6-5-7-9-15)19(24)18(23)20-16-10-12-17(13-11-16)21(2)3/h5-13H,4,14H2,1-3H3,(H,20,23).
What are the key properties of N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide?
N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide has a molecular weight of 325.41 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-[4-(dimethylamino)phenyl]-N'-ethyloxamide is sourced from PubChem (CID 108523230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).