C25H28N4O2 — CID 55437961
N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-4-(phenylcarbamoylamino)benzamide (PubChem CID 55437961) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-4-(phenylcarbamoylamino)benzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-4-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 55437961 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-4-(phenylcarbamoylamino)benzamide |
| SMILES | CCN(Cc1ccc(N(C)C)cc1)C(=O)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N4O2/c1-4-29(18-19-10-16-23(17-11-19)28(2)3)24(30)20-12-14-22(15-13-20)27-25(31)26-21-8-6-5-7-9-21/h5-17H,4,18H2,1-3H3,(H2,26,27,31) |
| InChIKey | UAGQMTJANQNLIP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|