C22H23N3O — CID 112982864
1-[4-[benzyl(ethyl)amino]phenyl]-3-phenylurea (PubChem CID 112982864) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[4-[benzyl(ethyl)amino]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[benzyl(ethyl)amino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 112982864 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-[4-[benzyl(ethyl)amino]phenyl]-3-phenylurea |
| SMILES | CCN(Cc1ccccc1)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N3O/c1-2-25(17-18-9-5-3-6-10-18)21-15-13-20(14-16-21)24-22(26)23-19-11-7-4-8-12-19/h3-16H,2,17H2,1H3,(H2,23,24,26) |
| InChIKey | FMNCUOJRLIRDLN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|