C24H25N3O2 — CID 109047140
4-N-benzyl-1-N-[4-(dimethylamino)phenyl]-4-N-methylbenzene-1,4-dicarboxamide (PubChem CID 109047140) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-N-benzyl-1-N-[4-(dimethylamino)phenyl]-4-N-methylbenzene-1,4-dicarboxamide.
| Compound Name | 4-N-benzyl-1-N-[4-(dimethylamino)phenyl]-4-N-methylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109047140 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 4-N-benzyl-1-N-[4-(dimethylamino)phenyl]-4-N-methylbenzene-1,4-dicarboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc(C(=O)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-26(2)22-15-13-21(14-16-22)25-23(28)19-9-11-20(12-10-19)24(29)27(3)17-18-7-5-4-6-8-18/h4-16H,17H2,1-3H3,(H,25,28) |
| InChIKey | SGFKXZTXGCTVBR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|