C39H37N5O4 — CID 87274383
[bis[4-[[4-(dimethylamino)benzoyl]amino]phenyl]methylideneamino] 2-phenylacetate (PubChem CID 87274383) has the molecular formula C39H37N5O4 and a molecular weight of 639.76 g/mol. Its IUPAC name is [bis[4-[[4-(dimethylamino)benzoyl]amino]phenyl]methylideneamino] 2-phenylacetate.
| Compound Name | [bis[4-[[4-(dimethylamino)benzoyl]amino]phenyl]methylideneamino] 2-phenylacetate |
|---|---|
| PubChem CID | 87274383 |
| Molecular Formula | C39H37N5O4 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | [bis[4-[[4-(dimethylamino)benzoyl]amino]phenyl]methylideneamino] 2-phenylacetate |
| SMILES | CN(C)c1ccc(C(=O)Nc2ccc(C(=NOC(=O)Cc3ccccc3)c3ccc(NC(=O)c4ccc(N(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H37N5O4/c1-43(2)34-22-14-30(15-23-34)38(46)40-32-18-10-28(11-19-32)37(42-48-36(45)26-27-8-6-5-7-9-27)29-12-20-33(21-13-29)41-39(47)31-16-24-35(25-17-31)44(3)4/h5-25H,26H2,1-4H3,(H,40,46)(H,41,47) |
| InChIKey | FGQLEPATSWRXRX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|