C19H24N4O2 — CID 108527350
N-[4-(dimethylamino)phenyl]-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108527350) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108527350 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | CCN(CCc1ccncc1)C(=O)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H24N4O2/c1-4-23(14-11-15-9-12-20-13-10-15)19(25)18(24)21-16-5-7-17(8-6-16)22(2)3/h5-10,12-13H,4,11,14H2,1-3H3,(H,21,24) |
| InChIKey | NXVICWDAQUTABH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|