C22H30N4O2 — CID 108527424
N-[4-(diethylamino)-2-methylphenyl]-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108527424) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108527424 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | CCN(CCc1ccncc1)C(=O)C(=O)Nc1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C22H30N4O2/c1-5-25(6-2)19-8-9-20(17(4)16-19)24-21(27)22(28)26(7-3)15-12-18-10-13-23-14-11-18/h8-11,13-14,16H,5-7,12,15H2,1-4H3,(H,24,27) |
| InChIKey | CQHHBZZQNUSIGC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|