C15H23N3O2 — CID 108526067
N,N,N'-triethyl-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108526067) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N,N,N'-triethyl-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N,N,N'-triethyl-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108526067 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N,N,N'-triethyl-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | CCN(CC)C(=O)C(=O)N(CC)CCc1ccncc1 |
| InChI | InChI=1S/C15H23N3O2/c1-4-17(5-2)14(19)15(20)18(6-3)12-9-13-7-10-16-11-8-13/h7-8,10-11H,4-6,9,12H2,1-3H3 |
| InChIKey | HWOCOTAKIGFJOE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|