C17H18ClN3O2 — CID 108500313
N-(2-chlorophenyl)-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108500313) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N-(2-chlorophenyl)-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108500313 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(2-chlorophenyl)-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | CCN(CCc1ccncc1)C(=O)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H18ClN3O2/c1-2-21(12-9-13-7-10-19-11-8-13)17(23)16(22)20-15-6-4-3-5-14(15)18/h3-8,10-11H,2,9,12H2,1H3,(H,20,22) |
| InChIKey | GAZSNZLWLWDQHZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|