C18H28N4O2 — CID 108507261
N'-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108507261) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N'-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108507261 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N'-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | CCN(CCc1ccncc1)C(=O)C(=O)N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C18H28N4O2/c1-4-22(14-7-15-5-10-19-11-6-15)18(24)17(23)21(3)16-8-12-20(2)13-9-16/h5-6,10-11,16H,4,7-9,12-14H2,1-3H3 |
| InChIKey | IWGSMZITPDWVNO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|