C20H23N3O2 — CID 108505672
2-(3,4-dihydro-2H-quinolin-1-yl)-N-ethyl-2-oxo-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 108505672) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N-ethyl-2-oxo-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-ethyl-2-oxo-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 108505672 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-ethyl-2-oxo-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | CCN(CCc1ccncc1)C(=O)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H23N3O2/c1-2-22(15-11-16-9-12-21-13-10-16)19(24)20(25)23-14-5-7-17-6-3-4-8-18(17)23/h3-4,6,8-10,12-13H,2,5,7,11,14-15H2,1H3 |
| InChIKey | GYHULWJTNFZDPA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|