C18H18N2O2 — CID 108505624
2-(3,4-dihydro-2H-quinolin-1-yl)-N-methyl-2-oxo-N-phenylacetamide (PubChem CID 108505624) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N-methyl-2-oxo-N-phenylacetamide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-methyl-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 108505624 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-methyl-2-oxo-N-phenylacetamide |
| SMILES | CN(C(=O)C(=O)N1CCCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c1-19(15-10-3-2-4-11-15)17(21)18(22)20-13-7-9-14-8-5-6-12-16(14)20/h2-6,8,10-12H,7,9,13H2,1H3 |
| InChIKey | RXZZMCHBUWVSEJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|