C19H21N3O2 — CID 108505690
2-(3,4-dihydro-2H-quinolin-1-yl)-N-[3-(dimethylamino)phenyl]-2-oxoacetamide (PubChem CID 108505690) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[3-(dimethylamino)phenyl]-2-oxoacetamide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[3-(dimethylamino)phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108505690 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[3-(dimethylamino)phenyl]-2-oxoacetamide |
| SMILES | CN(C)c1cccc(NC(=O)C(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-21(2)16-10-5-9-15(13-16)20-18(23)19(24)22-12-6-8-14-7-3-4-11-17(14)22/h3-5,7,9-11,13H,6,8,12H2,1-2H3,(H,20,23) |
| InChIKey | IASFCSSZGCPNPC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|