C16H13FN2O2 — CID 108531920
2-(2,3-dihydroindol-1-yl)-N-(3-fluorophenyl)-2-oxoacetamide (PubChem CID 108531920) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-N-(3-fluorophenyl)-2-oxoacetamide.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-N-(3-fluorophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108531920 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-N-(3-fluorophenyl)-2-oxoacetamide |
| SMILES | O=C(Nc1cccc(F)c1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H13FN2O2/c17-12-5-3-6-13(10-12)18-15(20)16(21)19-9-8-11-4-1-2-7-14(11)19/h1-7,10H,8-9H2,(H,18,20) |
| InChIKey | UIBLFQUFNUEBNI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|