C20H16N2O3 — CID 108509407
2-(2,3-dihydroindol-1-yl)-N-(5-hydroxynaphthalen-1-yl)-2-oxoacetamide (PubChem CID 108509407) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-N-(5-hydroxynaphthalen-1-yl)-2-oxoacetamide.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-N-(5-hydroxynaphthalen-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108509407 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-N-(5-hydroxynaphthalen-1-yl)-2-oxoacetamide |
| SMILES | O=C(Nc1cccc2c(O)cccc12)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H16N2O3/c23-18-10-4-6-14-15(18)7-3-8-16(14)21-19(24)20(25)22-12-11-13-5-1-2-9-17(13)22/h1-10,23H,11-12H2,(H,21,24) |
| InChIKey | WRUPQHNZXUYDHT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|