C19H20N2O3 — CID 108986778
2-(2,3-dihydroindol-1-yl)-2-oxo-N-(2-propan-2-yloxyphenyl)acetamide (PubChem CID 108986778) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-2-oxo-N-(2-propan-2-yloxyphenyl)acetamide.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-2-oxo-N-(2-propan-2-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 108986778 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-2-oxo-N-(2-propan-2-yloxyphenyl)acetamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H20N2O3/c1-13(2)24-17-10-6-4-8-15(17)20-18(22)19(23)21-12-11-14-7-3-5-9-16(14)21/h3-10,13H,11-12H2,1-2H3,(H,20,22) |
| InChIKey | KWYFKJKBOFSWTO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|