C19H22N2O2 — CID 110452888
1-[5-(2-propan-2-yloxyanilino)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 110452888) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-[5-(2-propan-2-yloxyanilino)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-(2-propan-2-yloxyanilino)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 110452888 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[5-(2-propan-2-yloxyanilino)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(Nc3ccccc3OC(C)C)ccc21 |
| InChI | InChI=1S/C19H22N2O2/c1-13(2)23-19-7-5-4-6-17(19)20-16-8-9-18-15(12-16)10-11-21(18)14(3)22/h4-9,12-13,20H,10-11H2,1-3H3 |
| InChIKey | JOEVBPBQRBAQLD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |