C17H16ClN3OS — CID 2727568
1-(1-acetyl-2,3-dihydroindol-5-yl)-3-(2-chlorophenyl)thiourea (PubChem CID 2727568) has the molecular formula C17H16ClN3OS and a molecular weight of 345.86 g/mol. Its IUPAC name is 1-(1-acetyl-2,3-dihydroindol-5-yl)-3-(2-chlorophenyl)thiourea.
| Compound Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-3-(2-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 2727568 |
| Molecular Formula | C17H16ClN3OS |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-3-(2-chlorophenyl)thiourea |
| SMILES | CC(=O)N1CCc2cc(NC(=S)Nc3ccccc3Cl)ccc21 |
| InChI | InChI=1S/C17H16ClN3OS/c1-11(22)21-9-8-12-10-13(6-7-16(12)21)19-17(23)20-15-5-3-2-4-14(15)18/h2-7,10H,8-9H2,1H3,(H2,19,20,23) |
| InChIKey | OMKGNXODKOFSEY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|