C19H16Cl2N2O2 — CID 97428981
(Z)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 97428981) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is (Z)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 97428981 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (Z)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | CC(=O)N1CCc2cc(NC(=O)/C=C\c3ccc(Cl)c(Cl)c3)ccc21 |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-12(24)23-9-8-14-11-15(4-6-18(14)23)22-19(25)7-3-13-2-5-16(20)17(21)10-13/h2-7,10-11H,8-9H2,1H3,(H,22,25)/b7-3- |
| InChIKey | KYAYTLITZUFDJS-CLTKARDFSA-N |
| XLogP | 4.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|